CymitQuimica logo

CAS 1228665-72-2

:

2-Methoxy-6-(1-pyrrolidinyl)-3-pyridinecarboxylic acid

Description:
2-Methoxy-6-(1-pyrrolidinyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine and carboxylic acid functional groups, along with a methoxy and a pyrrolidine substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the methoxy group can influence its solubility and reactivity, while the pyrrolidine ring may enhance its interaction with biological targets, potentially affecting its pharmacological profile. The carboxylic acid group is likely to impart acidic characteristics, making it soluble in polar solvents. Additionally, the compound may exhibit specific stereochemistry due to the presence of the pyrrolidine moiety, which can influence its binding affinity and selectivity in biological systems. Overall, 2-Methoxy-6-(1-pyrrolidinyl)-3-pyridinecarboxylic acid is of interest in medicinal chemistry, particularly for its potential applications in drug development and therapeutic interventions.
Formula:C11H14N2O3
InChI:InChI=1S/C11H14N2O3/c1-16-10-8(11(14)15)4-5-9(12-10)13-6-2-3-7-13/h4-5H,2-3,6-7H2,1H3,(H,14,15)
InChI key:InChIKey=XWNCVUABFXDCBB-UHFFFAOYSA-N
SMILES:O(C)C1=NC(=CC=C1C(O)=O)N2CCCC2
Synonyms:
  • 2-Methoxy-6-(1-pyrrolidinyl)-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 2-methoxy-6-(1-pyrrolidinyl)-
  • 2-Methoxy-6-(pyrrolidin-1-yl)nicotinic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.