CAS 1228665-73-3

5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine

Description:

5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both a fluorine atom and a trimethylsilyl group. The presence of the fluorine atom typically enhances the compound's reactivity and can influence its electronic properties, making it useful in various synthetic applications. The trimethylsilyl group serves as a protecting group for functionalization and can also improve the compound's solubility in organic solvents. This compound is of interest in medicinal chemistry and material science due to its potential biological activity and utility in the development of pharmaceuticals. Its molecular structure contributes to its stability and reactivity, making it a valuable intermediate in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used, which are important considerations for its practical applications in research and industry.

Formula: C₁₀H₁₃FN₂Si

InChI: InChI=1S/C10H13FN2Si/c1-14(2,3)9-7-4-5-12-10(7)13-6-8(9)11/h4-6H,1-3H3,(H,12,13)

InChI key: InChIKey=HTTKHFGDRKTCMS-UHFFFAOYSA-N

SMILES: [Si](C)(C)(C)C1=C2C(=NC=C1F)NC=C2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 5-fluoro-4-(trimethylsilyl)-
• 5-Fluoro-4-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine