CAS 1228665-74-4
:5-Bromo-2-(trimethylsilyl)furo[2,3-b]pyridine
Description:
5-Bromo-2-(trimethylsilyl)furo[2,3-b]pyridine is a heterocyclic organic compound characterized by the presence of both a bromine atom and a trimethylsilyl group attached to a fused furo-pyridine structure. This compound features a pyridine ring fused to a furan moiety, which contributes to its unique chemical properties. The bromine substituent enhances its reactivity, making it a useful intermediate in various synthetic applications, particularly in medicinal chemistry and material science. The trimethylsilyl group serves as a protecting group for functionalization and can influence the compound's solubility and stability. Additionally, the presence of these functional groups can affect the compound's electronic properties, making it suitable for applications in organic electronics or as a ligand in coordination chemistry. Overall, 5-Bromo-2-(trimethylsilyl)furo[2,3-b]pyridine is a versatile compound with potential applications in diverse fields, including pharmaceuticals and advanced materials.
Formula:C10H12BrNOSi
InChI:InChI=1S/C10H12BrNOSi/c1-14(2,3)9-5-7-4-8(11)6-12-10(7)13-9/h4-6H,1-3H3
InChI key:InChIKey=XVBPLCGYJFHHSE-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C=1OC=2C(C1)=CC(Br)=CN2
Synonyms:- 5-Bromo-2-(trimethylsilyl)furo[2,3-b]pyridine
- Furo[2,3-b]pyridine, 5-bromo-2-(trimethylsilyl)-
- (5-Bromofuro[2,3-b]pyridin-2-yl)-trimethylsilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.