CAS 1228665-75-5
:4-Chloro-5-fluoro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Description:
4-Chloro-5-fluoro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrrolopyridine core. This compound features a chloro and a fluoro substituent, contributing to its unique chemical reactivity and potential biological activity. The presence of the phenylsulfonyl group enhances its solubility and may influence its interaction with biological targets, making it of interest in medicinal chemistry. The compound is typically solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of targeted therapies. The specific arrangement of atoms and functional groups can lead to diverse chemical properties, including varying degrees of polarity and reactivity. As with many heterocyclic compounds, it may also exhibit interesting electronic properties, which could be leveraged in various chemical reactions or applications in material science. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C13H8ClFN2O2S
InChI:InChI=1S/C13H8ClFN2O2S/c14-12-10-6-7-17(13(10)16-8-11(12)15)20(18,19)9-4-2-1-3-5-9/h1-8H
InChI key:InChIKey=QSUVWTPAECZSPS-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(=C(Cl)C(F)=CN2)C=C1)C3=CC=CC=C3
Synonyms:- 4-Chloro-5-fluoro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
- 1-(Benzenesulfonyl)-4-chloro-5-fluoropyrrolo[2,3-b]pyridine
- [[4-Chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridin-1-yl]sulfonyl]benzene
- 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-5-fluoro-1-(phenylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.