CAS 1228665-79-9
:1-(2,3-Dihydro-6-iodo-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-1-propanone
Description:
1-(2,3-Dihydro-6-iodo-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-1-propanone is a complex organic compound characterized by its unique structural features, including a pyrido[2,3-b][1,4]oxazine core and a ketone functional group. The presence of iodine in its structure suggests potential reactivity and applications in various chemical reactions, particularly in the synthesis of other compounds. The compound's dimethyl substitution on the propanone moiety indicates steric hindrance, which may influence its reactivity and interaction with biological systems. This substance may exhibit interesting pharmacological properties due to its heterocyclic nature, making it a candidate for further research in medicinal chemistry. Additionally, the compound's molecular weight and solubility characteristics would be essential for understanding its behavior in different solvents and environments. Overall, this compound represents a class of heterocyclic compounds that could have significant implications in drug development and organic synthesis.
Formula:C12H15IN2O2
InChI:InChI=1S/C12H15IN2O2/c1-12(2,3)11(16)15-6-7-17-10-8(15)4-5-9(13)14-10/h4-5H,6-7H2,1-3H3
InChI key:InChIKey=ZMRLYMRYNIFQRA-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(=O)N1C=2C(=NC(I)=CC2)OCC1
Synonyms:- 1-Propanone, 1-(2,3-dihydro-6-iodo-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-
- 1-(2,3-Dihydro-6-iodo-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-1-propanone
- 1-(6-Iodo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethylpropan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.