CymitQuimica logo

CAS 1228665-83-5

:

3-Furo[3,2-b]pyridin-6-yl-2-propyn-1-ol

Description:
3-Furo[3,2-b]pyridin-6-yl-2-propyn-1-ol is a chemical compound characterized by its unique bicyclic structure, which incorporates both a furan and a pyridine ring. This compound features a hydroxyl group (-OH) and a propynyl group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the furan and pyridine moieties suggests that it may exhibit interesting biological activities, possibly acting as a ligand or a precursor in drug development. The compound's molecular structure allows for various functionalization possibilities, making it a versatile building block in synthetic chemistry. Additionally, its solubility and stability in different solvents can influence its behavior in chemical reactions. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity. Overall, 3-Furo[3,2-b]pyridin-6-yl-2-propyn-1-ol represents a valuable compound for research and development in various chemical fields.
Formula:C10H7NO2
InChI:InChI=1S/C10H7NO2/c12-4-1-2-8-6-10-9(11-7-8)3-5-13-10/h3,5-7,12H,4H2
InChI key:InChIKey=WDLPHXMCBCZIAL-UHFFFAOYSA-N
SMILES:C(#CCO)C=1C=C2C(=NC1)C=CO2
Synonyms:
  • 3-Furo[3,2-b]pyridin-6-yl-2-propyn-1-ol
  • 2-Propyn-1-ol, 3-furo[3,2-b]pyridin-6-yl-
  • 3-(Furo[3,2-b]pyridin-6-yl)prop-2-yn-1-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.