CAS 1228665-87-9
:3-Pyridinecarbonitrile, 2-fluoro-6-(1-pyrrolidinyl)-
Description:
3-Pyridinecarbonitrile, 2-fluoro-6-(1-pyrrolidinyl)- is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a cyano group (-C≡N) at the 3-position and a fluorine atom at the 2-position contributes to its unique reactivity and properties. The 6-position features a pyrrolidine moiety, which is a five-membered saturated ring containing one nitrogen atom, enhancing the compound's potential for biological activity. This compound may exhibit polar characteristics due to the cyano and fluorine substituents, influencing its solubility in various solvents. Additionally, the presence of the pyrrolidine group may impart specific steric and electronic effects, making it of interest in medicinal chemistry and drug design. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many nitrogen-containing heterocycles, it may also exhibit interesting properties such as basicity and potential for coordination with metal ions.
Formula:C10H10FN3
InChI:InChI=1S/C10H10FN3/c11-10-8(7-12)3-4-9(13-10)14-5-1-2-6-14/h3-4H,1-2,5-6H2
InChI key:InChIKey=JBPGNRHVOLTXAJ-UHFFFAOYSA-N
SMILES:FC1=NC(=CC=C1C#N)N2CCCC2
Synonyms:- 2-Fluoro-6-(pyrrolidin-1-yl)nicotinonitrile
- 3-Pyridinecarbonitrile, 2-fluoro-6-(1-pyrrolidinyl)-
- 2-Fluoro-6-pyrrolidin-1-ylpyridine-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.