CymitQuimica logo

CAS 1228665-90-4

:

4-Chloro-5-fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine

Description:
4-Chloro-5-fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex ring structure, which includes both pyridine and pyrrole moieties. This compound features three halogen substituents: chlorine, fluorine, and iodine, which significantly influence its chemical reactivity and physical properties. The presence of these halogens can enhance the compound's biological activity, making it of interest in medicinal chemistry and drug development. The molecular structure contributes to its potential as a ligand in various chemical reactions and as a precursor in the synthesis of more complex molecules. Additionally, the compound's unique arrangement of atoms may impart specific electronic properties, affecting its interaction with biological targets. Its CAS number, 1228665-90-4, allows for precise identification in chemical databases and literature. Overall, 4-Chloro-5-fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine is notable for its structural complexity and potential applications in pharmaceuticals and materials science.
Formula:C7H3ClFIN2
InChI:InChI=1S/C7H3ClFIN2/c8-6-3(9)1-11-7-5(6)4(10)2-12-7/h1-2H,(H,11,12)
InChI key:InChIKey=GQIXDQQTKUFJIN-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC=C1F)NC=C2I
Synonyms:
  • 4-Chloro-5-fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-5-fluoro-3-iodo-
  • 5-Fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridin-4-yl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.