CAS 1228665-91-5
:4-Chloro-5-fluoro-6-iodo-1H-pyrrolo[2,3-b]pyridine
Description:
4-Chloro-5-fluoro-6-iodo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex ring structure, which includes both pyridine and pyrrole moieties. This compound features three halogen substituents: chlorine, fluorine, and iodine, which significantly influence its chemical reactivity and physical properties. The presence of these halogens can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in pharmaceutical research. The molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the compound's unique arrangement of atoms may impart specific electronic properties, which can be leveraged in various chemical reactions. Its synthesis typically involves multi-step processes that require careful handling due to the reactivity of halogenated compounds. Overall, 4-Chloro-5-fluoro-6-iodo-1H-pyrrolo[2,3-b]pyridine represents a valuable structure in the field of organic chemistry and drug discovery.
Formula:C7H3ClFIN2
InChI:InChI=1S/C7H3ClFIN2/c8-4-3-1-2-11-7(3)12-6(10)5(4)9/h1-2H,(H,11,12)
InChI key:InChIKey=RJMPUPGWZJBCAY-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(I)=C1F)NC=C2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-5-fluoro-6-iodo-
- 4-Chloro-5-fluoro-6-iodo-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.