CAS 1228665-93-7
:1-(2,2-Dimethyl-1-oxopropyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid
Description:
1-(2,2-Dimethyl-1-oxopropyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid, identified by its CAS number 1228665-93-7, is a complex organic compound characterized by its unique structural features, including a pyrido[2,3-b][1,4]oxazine core. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in various organic solvents. The presence of a carboxylic acid functional group suggests it may engage in hydrogen bonding and participate in acid-base reactions. Additionally, the dimethyl substituent on the propyl group may influence its steric properties and reactivity. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological applications. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or detailed literature references. Overall, this compound represents a class of molecules that may have significant implications in drug development and other chemical applications.
Formula:C13H16N2O4
InChI:InChI=1S/C13H16N2O4/c1-13(2,3)12(18)15-6-7-19-10-9(15)5-4-8(14-10)11(16)17/h4-5H,6-7H2,1-3H3,(H,16,17)
InChI key:InChIKey=CCIBOAMARZYIMD-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(=O)N1C=2C(=NC(C(O)=O)=CC2)OCC1
Synonyms:- 1H-Pyrido[2,3-b][1,4]oxazine-6-carboxylic acid, 1-(2,2-dimethyl-1-oxopropyl)-2,3-dihydro-
- 1-(2,2-Dimethyl-1-oxopropyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-6-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Pivaloyl-2,3-dihydro-1h-pyrido[2,3-b][1,4]-oxazine-6-carboxylic acid
CAS:Formula:C13H16N2O4Molecular weight:264.2771
