CymitQuimica logo

CAS 1228665-96-0

:

2-Fluoro-6-(1-pyrrolidinyl)-4-pyridinecarboxylic acid

Description:
2-Fluoro-6-(1-pyrrolidinyl)-4-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is substituted with a fluorine atom and a pyrrolidine moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the fluorine atom can influence the compound's reactivity and polarity, potentially enhancing its biological activity. The pyrrolidine group may impart specific steric and electronic characteristics, affecting how the molecule interacts with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the pyridine and pyrrolidine structures can lead to variations in pharmacological properties. Additionally, its solubility and stability in various solvents can be influenced by the functional groups present. Overall, 2-Fluoro-6-(1-pyrrolidinyl)-4-pyridinecarboxylic acid exemplifies the complexity of heterocyclic compounds and their relevance in pharmaceutical research.
Formula:C10H11FN2O2
InChI:InChI=1S/C10H11FN2O2/c11-8-5-7(10(14)15)6-9(12-8)13-3-1-2-4-13/h5-6H,1-4H2,(H,14,15)
InChI key:InChIKey=VWAYZTJRTOUOEB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(N=C(F)C1)N2CCCC2
Synonyms:
  • 4-Pyridinecarboxylic acid, 2-fluoro-6-(1-pyrrolidinyl)-
  • 2-Fluoro-6-(1-pyrrolidinyl)-4-pyridinecarboxylic acid
  • 2-fluoro-6-pyrrolidin-1-ylpyridine-4-carboxylic acid
  • 2-Fluoro-6-(pyrrolidin-1-yl)isonicotinic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.