CAS 1228665-98-2

2,3-Bis(phenylmethoxy)pyridine

Description:

2,3-Bis(phenylmethoxy)pyridine is an organic compound characterized by its pyridine ring substituted with two phenylmethoxy groups at the 2 and 3 positions. This structure imparts unique chemical properties, including potential lipophilicity due to the presence of the bulky phenyl groups, which can influence its solubility and reactivity. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests that it could participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Additionally, the presence of the pyridine nitrogen can contribute to hydrogen bonding and coordination with metal ions, potentially enhancing its reactivity in coordination chemistry. As with many organic compounds, the stability and reactivity of 2,3-Bis(phenylmethoxy)pyridine can be influenced by environmental factors such as temperature and pH. Overall, this compound's unique structure and properties make it a subject of interest in various fields of chemical research.

Formula: C₁₉H₁₇NO₂

InChI: InChI=1S/C19H17NO2/c1-3-8-16(9-4-1)14-21-18-12-7-13-20-19(18)22-15-17-10-5-2-6-11-17/h1-13H,14-15H2

InChI key: InChIKey=FKBLXSTVQUPYIR-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C(OCC3=CC=CC=C3)N=CC=C2

Synonyms:

• 2,3-Bis(benzyloxy)pyridine
• 2,3-Bis(phenylmethoxy)pyridine
• Pyridine, 2,3-bis(phenylmethoxy)-