CAS 1228665-99-3

Methyl 2-amino-5-fluoro-3-pyridinepropanoate

Description:

Methyl 2-amino-5-fluoro-3-pyridinepropanoate is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the amino group (-NH2) and the fluoro group (-F) on the pyridine ring contributes to its reactivity and potential biological activity. This compound features an ester functional group, indicated by the methyl ester moiety, which can influence its solubility and stability. The structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its unique combination of functional groups may also impart specific pharmacological properties, making it of interest in medicinal chemistry. The CAS number 1228665-99-3 serves as a unique identifier for this compound, facilitating its identification in chemical databases and literature. Overall, Methyl 2-amino-5-fluoro-3-pyridinepropanoate is a compound of interest for research in organic synthesis and potential therapeutic applications.

Formula: C₉H₁₁FN₂O₂

InChI: InChI=1S/C9H11FN2O2/c1-14-8(13)3-2-6-4-7(10)5-12-9(6)11/h4-5H,2-3H2,1H3,(H2,11,12)

InChI key: InChIKey=YKQARTJZEXCQLQ-UHFFFAOYSA-N

SMILES: C(CC(OC)=O)C1=C(N)N=CC(F)=C1

Synonyms:

• 3-Pyridinepropanoic acid, 2-amino-5-fluoro-, methyl ester
• Methyl 2-amino-5-fluoro-3-pyridinepropanoate