CymitQuimica logo

CAS 1228666-00-9

:

2-Methoxy-5-methyl-3-[1-(phenylmethyl)-3-pyrrolidinyl]pyridine

Description:
2-Methoxy-5-methyl-3-[1-(phenylmethyl)-3-pyrrolidinyl]pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a methoxy group and a methyl group, as well as a pyrrolidine moiety attached to a phenylmethyl group. This compound is likely to exhibit properties typical of both pyridine and pyrrolidine derivatives, such as potential basicity due to the nitrogen atoms in the rings. The presence of the methoxy group may enhance its lipophilicity, influencing its solubility in organic solvents. Additionally, the phenylmethyl substitution could impart unique pharmacological properties, making it of interest in medicinal chemistry. The compound may also exhibit specific reactivity patterns due to the electron-donating and electron-withdrawing effects of its substituents. Overall, 2-Methoxy-5-methyl-3-[1-(phenylmethyl)-3-pyrrolidinyl]pyridine represents a structurally diverse molecule that could have applications in drug development or as a research chemical, although specific biological activities would require further investigation.
Formula:C18H22N2O
InChI:InChI=1S/C18H22N2O/c1-14-10-17(18(21-2)19-11-14)16-8-9-20(13-16)12-15-6-4-3-5-7-15/h3-7,10-11,16H,8-9,12-13H2,1-2H3
InChI key:InChIKey=AHBXRADRQXAJOS-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(C)C=N1)C2CN(CC3=CC=CC=C3)CC2
Synonyms:
  • 2-Methoxy-5-methyl-3-[1-(phenylmethyl)-3-pyrrolidinyl]pyridine
  • Pyridine, 2-methoxy-5-methyl-3-[1-(phenylmethyl)-3-pyrrolidinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.