CAS 1228666-01-0

5-Fluoro-4-[2-(trimethylsilyl)ethynyl]-1H-pyrrolo[2,3-b]pyridine

Description:

5-Fluoro-4-[2-(trimethylsilyl)ethynyl]-1H-pyrrolo[2,3-b]pyridine is a synthetic organic compound characterized by its unique structural features, which include a pyrrolopyridine core and a trimethylsilyl group attached to an ethynyl moiety. The presence of the fluorine atom enhances its electronic properties, potentially influencing its reactivity and interaction with biological targets. This compound is typically used in medicinal chemistry and drug development due to its potential pharmacological activities. The trimethylsilyl group serves as a protecting group or a functional handle for further chemical modifications, making it versatile in synthetic applications. Its molecular structure suggests that it may exhibit interesting properties such as lipophilicity and stability, which are crucial for bioavailability in pharmaceutical contexts. Additionally, the compound's CAS number, 1228666-01-0, allows for precise identification and retrieval of information regarding its synthesis, safety data, and regulatory status. Overall, this compound represents a valuable entity in the exploration of new therapeutic agents.

Formula: C₁₂H₁₃FN₂Si

InChI: InChI=1S/C12H13FN2Si/c1-16(2,3)7-5-9-10-4-6-14-12(10)15-8-11(9)13/h4,6,8H,1-3H3,(H,14,15)

InChI key: InChIKey=CWLBIWBZPQAUCP-UHFFFAOYSA-N

SMILES: C(#C[Si](C)(C)C)C1=C2C(=NC=C1F)NC=C2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 5-fluoro-4-[2-(trimethylsilyl)ethynyl]-
• 5-Fluoro-4-[2-(trimethylsilyl)ethynyl]-1H-pyrrolo[2,3-b]pyridine