CAS 1228666-02-1
:2,3-Dihydro-1H-pyrido[3,4-b][1,4]oxazine-8-carbonitrile
Description:
2,3-Dihydro-1H-pyrido[3,4-b][1,4]oxazine-8-carbonitrile is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both nitrogen and oxygen atoms within its rings. This compound features a pyridine-like moiety fused to an oxazine ring, contributing to its unique chemical properties. The presence of a carbonitrile group enhances its reactivity, making it a potential candidate for various chemical transformations. Typically, compounds of this nature exhibit moderate to high polarity due to the electronegative atoms in their structure, which can influence their solubility in polar solvents. Additionally, the bicyclic framework may impart specific biological activities, making it of interest in medicinal chemistry. Its synthesis often involves multi-step reactions, and it may serve as an intermediate in the development of pharmaceuticals or agrochemicals. Overall, 2,3-Dihydro-1H-pyrido[3,4-b][1,4]oxazine-8-carbonitrile represents a class of compounds with diverse applications in chemical research and industry.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c9-3-6-4-10-5-7-8(6)11-1-2-12-7/h4-5,11H,1-2H2
InChI key:InChIKey=DVJWNFFEBFNWIU-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(=CN=C1)OCCN2
Synonyms:- 1H-Pyrido[3,4-b][1,4]oxazine-8-carbonitrile, 2,3-dihydro-
- 2,3-Dihydro-1H-pyrido[3,4-b][1,4]oxazine-8-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.