CAS 1228666-05-4

2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinemethanol

Description:

2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinemethanol is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a fluorine atom and a pyrrolidine moiety. This compound typically exhibits properties associated with both its aromatic and aliphatic components, such as moderate solubility in polar solvents due to the presence of the hydroxyl group. The fluorine substitution can influence its reactivity and biological activity, potentially enhancing lipophilicity and altering pharmacokinetic properties. The presence of the pyrrolidine ring may contribute to its ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential applications in drug development, particularly in the design of agents targeting neurological or psychiatric conditions. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH and temperature. Safety data and handling precautions should be consulted due to the potential hazards associated with fluorinated compounds.

Formula: C₁₀H₁₃FN₂O

InChI: InChI=1S/C10H13FN2O/c11-10-8(7-14)3-4-9(12-10)13-5-1-2-6-13/h3-4,14H,1-2,5-7H2

InChI key: InChIKey=RNUQRVOOLHSXKN-UHFFFAOYSA-N

SMILES: FC1=NC(=CC=C1CO)N2CCCC2

Synonyms:

• 2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinemethanol
• 3-Pyridinemethanol, 2-fluoro-6-(1-pyrrolidinyl)-