CymitQuimica logo

CAS 1228666-08-7

:

5-Fluoro-4-[2-(trimethylsilyl)ethynyl]-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine

Description:
5-Fluoro-4-[2-(trimethylsilyl)ethynyl]-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, including a pyrrolo[2,3-b]pyridine core, which contributes to its potential biological activity. The presence of a fluorine atom enhances its electronic properties, potentially influencing its reactivity and interaction with biological targets. The trimethylsilyl and tris(1-methylethyl)silyl groups provide significant steric bulk, which can affect the compound's solubility and stability. This compound is likely to exhibit interesting pharmacological properties due to its structural motifs, making it a candidate for research in medicinal chemistry. Its synthesis and characterization would involve advanced organic chemistry techniques, and it may be utilized in various applications, including drug development and material science. As with many organosilicon compounds, it may also exhibit unique physical properties, such as volatility and thermal stability, which are important for its handling and application in laboratory settings.
Formula:C21H33FN2Si2
InChI:InChI=1S/C21H33FN2Si2/c1-15(2)26(16(3)4,17(5)6)24-12-10-19-18(11-13-25(7,8)9)20(22)14-23-21(19)24/h10,12,14-17H,1-9H3
InChI key:InChIKey=DQSQFVRJMSFYEU-UHFFFAOYSA-N
SMILES:[Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=C(C#C[Si](C)(C)C)C(F)=CN2
Synonyms:
  • 5-Fluoro-4-[2-(trimethylsilyl)ethynyl]-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 5-fluoro-4-[2-(trimethylsilyl)ethynyl]-1-[tris(1-methylethyl)silyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.