CymitQuimica logo

CAS 1228666-11-2

:

2-Methoxy-6-(1-pyrrolidinyl)-3-pyridinecarboxaldehyde

Description:
2-Methoxy-6-(1-pyrrolidinyl)-3-pyridinecarboxaldehyde is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a methoxy group and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the aldehyde functional group suggests it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the methoxy group can influence the compound's solubility and polarity, while the pyrrolidine ring may impart specific steric and electronic effects. Due to its structural complexity, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and its applications could span across fields such as pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity.
Formula:C11H14N2O2
InChI:InChI=1S/C11H14N2O2/c1-15-11-9(8-14)4-5-10(12-11)13-6-2-3-7-13/h4-5,8H,2-3,6-7H2,1H3
InChI key:InChIKey=DUXXVGOFEXESLC-UHFFFAOYSA-N
SMILES:O(C)C1=NC(=CC=C1C=O)N2CCCC2
Synonyms:
  • 3-Pyridinecarboxaldehyde, 2-methoxy-6-(1-pyrrolidinyl)-
  • 2-Methoxy-6-(1-pyrrolidinyl)-3-pyridinecarboxaldehyde
  • 2-Methoxy-6-(pyrrolidin-1-yl)nicotinaldehyde
  • 2-methoxy-6-(pyrrolidin-1-yl)pyridine-3-carbaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.