CAS 1228666-14-5
:2-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-propyn-1-yl]-3-(phenylmethoxy)pyridine
Description:
2-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-propyn-1-yl]-3-(phenylmethoxy)pyridine, with CAS number 1228666-14-5, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyridine ring, a propynyl group, and a silyl ether moiety. The presence of the dimethylethylsilyl group suggests that the compound may exhibit unique properties such as increased hydrophobicity and stability, which can influence its reactivity and solubility in various solvents. The phenylmethoxy substituent adds to its structural diversity, potentially enhancing its interactions in biological systems or chemical reactions. This compound may be of interest in medicinal chemistry or materials science due to its potential applications in drug development or as a functional material. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed computational analysis for a comprehensive understanding of its behavior in different environments.
Formula:C21H27NO2Si
InChI:InChI=1S/C21H27NO2Si/c1-21(2,3)25(4,5)24-16-10-13-19-20(14-9-15-22-19)23-17-18-11-7-6-8-12-18/h6-9,11-12,14-15H,16-17H2,1-5H3
InChI key:InChIKey=XVXJKJUCWBOPNL-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(C#CCO[Si](C(C)(C)C)(C)C)N=CC=C2
Synonyms:- 2-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-propyn-1-yl]-3-(phenylmethoxy)pyridine
- Pyridine, 2-[3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-1-propyn-1-yl]-3-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.