CAS 1228666-16-7
:6-Iodo-7-methyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
Description:
6-Iodo-7-methyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both a pyridine and an oxazine ring. The presence of the iodo substituent at the 6-position and a methyl group at the 7-position contributes to its unique chemical properties, influencing its reactivity and potential biological activity. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic nature, which may affect its solubility in organic solvents. The oxazinone moiety suggests potential for tautomerism, where the compound can exist in different forms depending on the environmental conditions. Additionally, the presence of halogens, such as iodine, often enhances the compound's reactivity, making it a candidate for various synthetic applications. Its structural features may also suggest potential pharmacological activities, warranting further investigation in medicinal chemistry. Overall, 6-Iodo-7-methyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one represents a compound of interest in both synthetic and biological chemistry contexts.
Formula:C8H7IN2O2
InChI:InChI=1S/C8H7IN2O2/c1-4-2-5-8(11-7(4)9)13-3-6(12)10-5/h2H,3H2,1H3,(H,10,12)
InChI key:InChIKey=MPLOVKMRKOUOTK-UHFFFAOYSA-N
SMILES:CC=1C=C2C(=NC1I)OCC(=O)N2
Synonyms:- 1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one, 6-iodo-7-methyl-
- 6-Iodo-7-methyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.