CAS 1228666-19-0

Methyl 2-fluoro-6-(1-pyrrolidinyl)-3-pyridinecarboxylate

Description:

Methyl 2-fluoro-6-(1-pyrrolidinyl)-3-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is substituted at specific positions with a fluorine atom and a pyrrolidine moiety. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The pyrrolidine group can impart unique steric and electronic properties, potentially affecting the compound's interaction with biological targets. This compound may be studied for its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is analyzed. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound.

Formula: C₁₁H₁₃FN₂O₂

InChI: InChI=1S/C11H13FN2O2/c1-16-11(15)8-4-5-9(13-10(8)12)14-6-2-3-7-14/h4-5H,2-3,6-7H2,1H3

InChI key: InChIKey=VRYUNSCOULEJPJ-UHFFFAOYSA-N

SMILES: FC1=NC(=CC=C1C(OC)=O)N2CCCC2

Synonyms:

• Methyl 2-fluoro-6-(1-pyrrolidinyl)-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 2-fluoro-6-(1-pyrrolidinyl)-, methyl ester