CymitQuimica logo

CAS 1228666-21-4

:

6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinecarboxylic acid

Description:
The chemical substance known as 6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinecarboxylic acid, with the CAS number 1228666-21-4, is characterized by its complex molecular structure, which includes a pyridine ring, a pyrrolidine moiety, and a dimethylsilyl group. This compound features a fluorine atom and a carboxylic acid functional group, contributing to its potential reactivity and solubility properties. The presence of the dimethylethylsilyl group suggests that the compound may exhibit unique hydrophobic characteristics, which can influence its interaction with biological systems and its overall stability. Additionally, the pyridine and pyrrolidine components may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, and its applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and efficacy. Overall, this substance represents a class of compounds that may have significant implications in various chemical and biological contexts.
Formula:C17H27FN2O3Si
InChI:InChI=1S/C17H27FN2O3Si/c1-17(2,3)24(4,5)23-11-12-8-9-20(10-12)14-7-6-13(16(21)22)15(18)19-14/h6-7,12H,8-11H2,1-5H3,(H,21,22)
InChI key:InChIKey=CFUCDNWBSUCSFQ-UHFFFAOYSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)C1CN(CC1)C=2N=C(F)C(C(O)=O)=CC2
Synonyms:
  • 3-Pyridinecarboxylic acid, 6-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-
  • 6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.