CymitQuimica logo

CAS 1228666-29-2

:

5-Bromo-2-ethyl-1H-pyrrolo[2,3-b]pyridine

Description:
5-Bromo-2-ethyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 5-position and an ethyl group at the 2-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish appearance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its heteroatom content can influence its electronic properties, potentially affecting its interaction with biological targets. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 5-Bromo-2-ethyl-1H-pyrrolo[2,3-b]pyridine is a significant compound in research and development within the field of organic chemistry.
Formula:C9H9BrN2
InChI:InChI=1S/C9H9BrN2/c1-2-8-4-6-3-7(10)5-11-9(6)12-8/h3-5H,2H2,1H3,(H,11,12)
InChI key:InChIKey=LEBUTEDILHIQJK-UHFFFAOYSA-N
SMILES:C(C)C=1NC=2C(C1)=CC(Br)=CN2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-2-ethyl-
  • 5-Bromo-2-ethyl-1H-pyrrolo[2,3-b]pyridine
Found 3 products.