CAS 1228666-32-7

6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinecarbonitrile

Description:

The chemical substance known as 6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinecarbonitrile, with the CAS number 1228666-32-7, is a synthetic organic compound characterized by its complex structure, which includes a pyridine ring, a pyrrolidine moiety, and a silyl ether functional group. The presence of a fluorine atom and a cyano group contributes to its potential reactivity and biological activity. This compound may exhibit properties typical of pyridine derivatives, such as being polar and capable of engaging in hydrogen bonding, which can influence its solubility and interaction with biological targets. The dimethylsilyl group enhances its stability and may affect its lipophilicity, making it relevant in medicinal chemistry and drug design. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₇H₂₆FN₃OSi

InChI: InChI=1S/C17H26FN3OSi/c1-17(2,3)23(4,5)22-12-13-8-9-21(11-13)15-7-6-14(10-19)16(18)20-15/h6-7,13H,8-9,11-12H2,1-5H3

InChI key: InChIKey=AWORSJZNQVJMQP-UHFFFAOYSA-N

SMILES: C(O[Si](C(C)(C)C)(C)C)C1CN(CC1)C=2N=C(F)C(C#N)=CC2

Synonyms:

• 6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinecarbonitrile
• 3-Pyridinecarbonitrile, 6-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-