CAS 1228666-33-8

5-Bromo-2-[(2,2-dimethyl-1-oxopropyl)amino]-4-pyridinyl 2,2-dimethylpropanoate

Description:

5-Bromo-2-[(2,2-dimethyl-1-oxopropyl)amino]-4-pyridinyl 2,2-dimethylpropanoate is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and an amino group linked to a dimethyl ketone moiety. This compound features a 2,2-dimethylpropanoate ester, contributing to its lipophilicity and potential bioactivity. The presence of the bromine atom may enhance its reactivity and influence its pharmacological properties. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique combination of functional groups may also impart specific solubility and stability characteristics, making it suitable for various chemical reactions or formulations. As with many organic compounds, the precise behavior and reactivity can be influenced by environmental factors such as pH and temperature, as well as interactions with other molecules. Further studies would be necessary to fully elucidate its properties and potential applications in research or industry.

Formula: C₁₅H₂₁BrN₂O₃

InChI: InChI=1S/C15H21BrN2O3/c1-14(2,3)12(19)18-11-7-10(9(16)8-17-11)21-13(20)15(4,5)6/h7-8H,1-6H3,(H,17,18,19)

InChI key: InChIKey=CZYFBLVXTCRMCV-UHFFFAOYSA-N

SMILES: O(C(C(C)(C)C)=O)C=1C=C(NC(C(C)(C)C)=O)N=CC1Br

Synonyms:

• 5-Bromo-2-[(2,2-dimethyl-1-oxopropyl)amino]-4-pyridinyl 2,2-dimethylpropanoate
• Propanoic acid, 2,2-dimethyl-, 5-bromo-2-[(2,2-dimethyl-1-oxopropyl)amino]-4-pyridinyl ester