CAS 1228666-35-0

2-Bromo-6-(5-oxazolyl)-3-(phenylmethoxy)pyridine

Description:

2-Bromo-6-(5-oxazolyl)-3-(phenylmethoxy)pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom, an oxazole ring, and a phenylmethoxy group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions. The oxazole moiety contributes to the compound's potential biological activity, as oxazoles are often found in pharmacologically active compounds. The phenylmethoxy group enhances the lipophilicity of the molecule, which may influence its solubility and permeability in biological systems. This compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its unique combination of functional groups suggests potential applications in areas such as agrochemicals, pharmaceuticals, or materials science. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications.

Formula: C₁₅H₁₁BrN₂O₂

InChI: InChI=1S/C15H11BrN2O2/c16-15-13(19-9-11-4-2-1-3-5-11)7-6-12(18-15)14-8-17-10-20-14/h1-8,10H,9H2

InChI key: InChIKey=SNEXISSXLANPHT-UHFFFAOYSA-N

SMILES: BrC1=NC(=CC=C1OCC2=CC=CC=C2)C3=CN=CO3

Synonyms:

• 2-Bromo-6-(5-oxazolyl)-3-(phenylmethoxy)pyridine
• Pyridine, 2-bromo-6-(5-oxazolyl)-3-(phenylmethoxy)-