CAS 1228666-37-2

5-Fluoro-3-(3-hydroxypropyl)-2(1H)-pyridinone

Description:

5-Fluoro-3-(3-hydroxypropyl)-2(1H)-pyridinone is a chemical compound characterized by its pyridinone structure, which features a fluorine atom and a hydroxypropyl group attached to the pyridine ring. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The fluorine substitution can influence the compound's reactivity and biological activity, potentially enhancing lipophilicity and altering pharmacokinetic properties. The presence of the hydroxypropyl group may also contribute to its solubility and interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could impart specific biological activities. As with many pyridinones, it may exhibit tautomeric behavior, existing in equilibrium between keto and enol forms, which can further influence its chemical reactivity and interactions. Overall, 5-Fluoro-3-(3-hydroxypropyl)-2(1H)-pyridinone represents a unique structure with potential applications in various fields, including drug development and chemical synthesis.

Formula: C₈H₁₀FNO₂

InChI: InChI=1S/C8H10FNO2/c9-7-4-6(2-1-3-11)8(12)10-5-7/h4-5,11H,1-3H2,(H,10,12)

InChI key: InChIKey=RUJNGNFQIPNDCF-UHFFFAOYSA-N

SMILES: C(CCO)C=1C(=O)NC=C(F)C1

Synonyms:

• 5-Fluoro-3-(3-hydroxypropyl)-2(1H)-pyridinone
• 2(1H)-Pyridinone, 5-fluoro-3-(3-hydroxypropyl)-