CAS 1228666-38-3
:2-Chloro-5-fluoro-3-pyridinepropanol
Description:
2-Chloro-5-fluoro-3-pyridinepropanol is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a propanol side chain, indicating the presence of a hydroxyl (-OH) group, which contributes to its potential as a polar molecule. The presence of both chlorine and fluorine substituents on the pyridine ring enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The chlorine atom typically introduces lipophilicity, while the fluorine atom can enhance metabolic stability and bioavailability. The compound's structure suggests it may exhibit unique properties such as solubility in polar solvents and potential interactions with biological targets. Its specific applications would depend on further studies, including its synthesis, stability, and reactivity under various conditions. Overall, 2-Chloro-5-fluoro-3-pyridinepropanol represents a versatile scaffold for further chemical exploration and potential pharmaceutical development.
Formula:C8H9ClFNO
InChI:InChI=1S/C8H9ClFNO/c9-8-6(2-1-3-12)4-7(10)5-11-8/h4-5,12H,1-3H2
InChI key:InChIKey=KMOGHFQZGPOKEM-UHFFFAOYSA-N
SMILES:C(CCO)C1=C(Cl)N=CC(F)=C1
Synonyms:- 3-Pyridinepropanol, 2-chloro-5-fluoro-
- 2-Chloro-5-fluoro-3-pyridinepropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
