CymitQuimica logo

CAS 1228666-39-4

:

2-Fluoro-N-methoxy-N-methyl-6-(1-pyrrolidinyl)-3-pyridinecarboxamide

Description:
2-Fluoro-N-methoxy-N-methyl-6-(1-pyrrolidinyl)-3-pyridinecarboxamide, with the CAS number 1228666-39-4, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a fluoro group and a carboxamide functional group. The presence of a methoxy and a methyl group, along with a pyrrolidinyl moiety, contributes to its unique chemical properties. This compound is likely to exhibit polar characteristics due to the presence of the methoxy and carboxamide groups, which can engage in hydrogen bonding. Its fluorine atom may enhance lipophilicity and influence the compound's reactivity and biological activity. The structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. As with many compounds containing nitrogen and fluorine, it may also exhibit interesting electronic properties, making it a candidate for further research in various chemical and biological contexts.
Formula:C12H16FN3O2
InChI:InChI=1S/C12H16FN3O2/c1-15(18-2)12(17)9-5-6-10(14-11(9)13)16-7-3-4-8-16/h5-6H,3-4,7-8H2,1-2H3
InChI key:InChIKey=CLZLPSKDHKZPHE-UHFFFAOYSA-N
SMILES:C(N(OC)C)(=O)C1=C(F)N=C(C=C1)N2CCCC2
Synonyms:
  • 3-Pyridinecarboxamide, 2-fluoro-N-methoxy-N-methyl-6-(1-pyrrolidinyl)-
  • 2-Fluoro-N-methoxy-N-methyl-6-(1-pyrrolidinyl)-3-pyridinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.