CAS 1228666-45-2
:N-[5-Bromo-2-(3-hydroxy-1-propyn-1-yl)-3-pyridinyl]-2,2-dimethylpropanamide
Description:
N-[5-Bromo-2-(3-hydroxy-1-propyn-1-yl)-3-pyridinyl]-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a brominated pyridine ring and a propynyl side chain with a hydroxyl group. The presence of the bromine atom enhances its reactivity and potential for forming various derivatives. The amide functional group contributes to its stability and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific pathways. Its molecular structure suggests potential interactions with biological macromolecules, which could be explored in medicinal chemistry. Additionally, the presence of the dimethylpropanamide moiety may influence its lipophilicity and permeability, affecting its pharmacokinetic properties. Overall, this compound's unique features make it a subject of interest for further investigation in both synthetic and medicinal chemistry contexts.
Formula:C13H15BrN2O2
InChI:InChI=1S/C13H15BrN2O2/c1-13(2,3)12(18)16-11-7-9(14)8-15-10(11)5-4-6-17/h7-8,17H,6H2,1-3H3,(H,16,18)
InChI key:InChIKey=XOZAOYOZEWOALO-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C(C#CCO)N=CC(Br)=C1
Synonyms:- N-[5-Bromo-2-(3-hydroxy-1-propyn-1-yl)-3-pyridinyl]-2,2-dimethylpropanamide
- Propanamide, N-[5-bromo-2-(3-hydroxy-1-propyn-1-yl)-3-pyridinyl]-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.