CymitQuimica logo

CAS 1228666-48-5

:

1-(1,1-Dimethylethyl) 3-methyl 4-formyl-1H-pyrrolo[2,3-b]pyridine-1,3-dicarboxylate

Description:
1-(1,1-Dimethylethyl) 3-methyl 4-formyl-1H-pyrrolo[2,3-b]pyridine-1,3-dicarboxylate, with the CAS number 1228666-48-5, is a complex organic compound characterized by its unique pyrrolopyridine structure. This compound features multiple functional groups, including a formyl group and two carboxylate moieties, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The methyl group at the 3-position may also affect the compound's steric and electronic properties. As a pyrrolopyridine derivative, it may exhibit interesting pharmacological activities, making it a candidate for further research in drug development. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the specific conditions under which it is handled. Overall, this compound represents a valuable structure for exploration in various chemical and pharmaceutical applications.
Formula:C15H16N2O5
InChI:InChI=1S/C15H16N2O5/c1-15(2,3)22-14(20)17-7-10(13(19)21-4)11-9(8-18)5-6-16-12(11)17/h5-8H,1-4H3
InChI key:InChIKey=GVFBOMUFVCYKOX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(N(C(OC(C)(C)C)=O)C1)=NC=CC2C=O
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-1,3-dicarboxylic acid, 4-formyl-, 1-(1,1-dimethylethyl) 3-methyl ester
  • 1-tert-Butyl 3-methyl 4-formyl-1H-pyrrolo[2,3-b]-pyridine-1,3-dicarboxylate
  • 1-(1,1-Dimethylethyl) 3-methyl 4-formyl-1H-pyrrolo[2,3-b]pyridine-1,3-dicarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.