CymitQuimica logo

CAS 1228666-49-6

:

1-(6-Bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-1-propanone

Description:
1-(6-Bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-1-propanone is a chemical compound characterized by its complex structure, which includes a pyrido[2,3-b][1,4]oxazine moiety and a ketone functional group. The presence of the bromine atom introduces notable reactivity, potentially influencing its chemical behavior and interactions. This compound may exhibit properties typical of both heterocyclic compounds and ketones, such as varying solubility in organic solvents and potential biological activity. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions, depending on the conditions. Additionally, the presence of the dimethyl group may affect steric hindrance and electronic properties, influencing its reactivity and stability. While specific physical properties like melting point, boiling point, and solubility are not provided, compounds of this nature often find applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to their potential biological activities.
Formula:C12H15BrN2O2
InChI:InChI=1S/C12H15BrN2O2/c1-12(2,3)11(16)15-6-7-17-10-8(15)4-5-9(13)14-10/h4-5H,6-7H2,1-3H3
InChI key:InChIKey=GSNJTWSMKVIJNQ-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(=O)N1C=2C(=NC(Br)=CC2)OCC1
Synonyms:
  • 1-Propanone, 1-(6-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-
  • 1-(6-Bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl)-2,2-dimethyl-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.