CymitQuimica logo

CAS 1228666-50-9

:

1-[6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinyl]ethanone

Description:
1-[6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinyl]ethanone, identified by its CAS number 1228666-50-9, is a synthetic organic compound characterized by its complex molecular structure. This substance features a pyridine ring substituted with a fluorine atom and a ketone functional group, which contributes to its reactivity and potential biological activity. The presence of a pyrrolidine moiety suggests possible interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the dimethylsilyl group indicates that the compound may exhibit unique properties related to its stability and solubility. The tert-butyl group enhances steric hindrance, potentially influencing the compound's interactions with other molecules. Overall, this compound's intricate structure and functional groups suggest it may have applications in pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation through empirical studies.
Formula:C18H29FN2O2Si
InChI:InChI=1S/C18H29FN2O2Si/c1-13(22)15-7-8-16(20-17(15)19)21-10-9-14(11-21)12-23-24(5,6)18(2,3)4/h7-8,14H,9-12H2,1-6H3
InChI key:InChIKey=NVDAGQQCTAXALU-UHFFFAOYSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)C1CN(CC1)C=2N=C(F)C(C(C)=O)=CC2
Synonyms:
  • Ethanone, 1-[6-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinyl]-
  • 1-[6-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.