CAS 1228666-51-0
:3-[2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinyl]-2-propyn-1-ol
Description:
3-[2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinyl]-2-propyn-1-ol, identified by its CAS number 1228666-51-0, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a fluorine atom and a pyrrolidine moiety. This compound features a propynol functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the fluorine atom often enhances the lipophilicity and metabolic stability of the molecule, making it a candidate for drug development. The pyrrolidine ring can influence the compound's pharmacological properties, potentially affecting its interaction with biological targets. Additionally, the overall structure suggests that it may exhibit interesting biological activities, which could be explored in various therapeutic contexts. As with many synthetic organic compounds, its solubility, stability, and reactivity would depend on the specific conditions under which it is handled. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.
Formula:C12H13FN2O
InChI:InChI=1S/C12H13FN2O/c13-12-10(4-3-9-16)5-6-11(14-12)15-7-1-2-8-15/h5-6,16H,1-2,7-9H2
InChI key:InChIKey=NLUUDIUPNHSUEG-UHFFFAOYSA-N
SMILES:FC1=NC(=CC=C1C#CCO)N2CCCC2
Synonyms:- 3-[2-Fluoro-6-(1-pyrrolidinyl)-3-pyridinyl]-2-propyn-1-ol
- 2-Propyn-1-ol, 3-[2-fluoro-6-(1-pyrrolidinyl)-3-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.