CAS 1228666-56-5

7-Bromo-2-methylpyrido[3,2-d]pyrimidin-4(3H)-one

Description:

7-Bromo-2-methylpyrido[3,2-d]pyrimidin-4(3H)-one is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. The presence of a bromine atom at the 7-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar organic solvents, and its structure suggests potential for hydrogen bonding due to the presence of the carbonyl group in the pyrimidinone moiety. The compound may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its reactivity can be influenced by the electron-withdrawing nature of the bromine substituent, which may affect its interaction with biological targets. Additionally, the compound's stability and reactivity can be further influenced by environmental factors such as pH and temperature. Overall, 7-Bromo-2-methylpyrido[3,2-d]pyrimidin-4(3H)-one represents a significant structure in the realm of heterocyclic chemistry with potential applications in drug discovery.

Formula: C₈H₆BrN₃O

InChI: InChI=1S/C8H6BrN3O/c1-4-11-6-2-5(9)3-10-7(6)8(13)12-4/h2-3H,1H3,(H,11,12,13)

InChI key: InChIKey=SUAHOXUNIGVBOJ-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC(C)=N1)=CC(Br)=CN2

Synonyms:

• 7-Bromo-2-methylpyrido[3,2-d]pyrimidin-4(3H)-one
• Pyrido[3,2-d]pyrimidin-4(3H)-one, 7-bromo-2-methyl-
• 7-Bromo-2-methylpyrido[3,2-d]pyrimidin-4-ol

7-Bromo-2-methylpyrido[3,2-d]pyrimidin-4-ol

CAS: 1228666-56-5

Formula: C₈H₆BrN₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 240.0567

Ref: IN-DA000JNP