CymitQuimica logo

CAS 1228666-59-8

:

1-(5-Fluoro-1H-pyrrolo[2,3-b]pyridin-4-yl)ethanone

Description:
1-(5-Fluoro-1H-pyrrolo[2,3-b]pyridin-4-yl)ethanone, with the CAS number 1228666-59-8, is a chemical compound characterized by its unique pyrrolopyridine structure, which incorporates a fluorine atom at the 5-position of the pyrrole ring. This compound features an ethanone functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a candidate for drug development. Its molecular structure suggests potential interactions with biological targets, particularly in the context of pharmacology. The compound may exhibit specific biological activities, which are often explored in the context of its derivatives. As with many heterocyclic compounds, it may possess interesting properties such as fluorescence or specific binding affinities, depending on its substituents and overall conformation. Safety and handling considerations are essential, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C9H7FN2O
InChI:InChI=1S/C9H7FN2O/c1-5(13)8-6-2-3-11-9(6)12-4-7(8)10/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=QOCUJDISJMTOMI-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C2C(=NC=C1F)NC=C2
Synonyms:
  • 1-(5-Fluoro-1H-pyrrolo[2,3-b]pyridin-4-yl)ethanone
  • Ethanone, 1-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.