CAS 1228666-60-1

5-Methylfuro[2,3-b]pyridine-2-methanol

Description:

5-Methylfuro[2,3-b]pyridine-2-methanol is a chemical compound characterized by its unique fused ring structure, which combines elements of furan and pyridine. This compound features a methyl group at the 5-position of the furo[2,3-b]pyridine framework and a hydroxymethyl group at the 2-position, contributing to its reactivity and potential applications in organic synthesis. The presence of both nitrogen and oxygen heteroatoms in its structure enhances its polarity and solubility in various solvents, making it suitable for diverse chemical reactions. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods. As with many heterocyclic compounds, it may also participate in various chemical transformations, including nucleophilic substitutions and electrophilic additions, making it a valuable intermediate in the synthesis of more complex molecules. Safety data and handling precautions should be consulted due to the potential hazards associated with chemical substances.

Formula: C₉H₉NO₂

InChI: InChI=1S/C9H9NO2/c1-6-2-7-3-8(5-11)12-9(7)10-4-6/h2-4,11H,5H2,1H3

InChI key: InChIKey=GIGQFINHHUTCAQ-UHFFFAOYSA-N

SMILES: C(O)C=1OC=2C(C1)=CC(C)=CN2

Synonyms:

• 5-Methylfuro[2,3-b]pyridine-2-methanol
• Furo[2,3-b]pyridine-2-methanol, 5-methyl-