CAS 1228670-10-7

2-Methoxy-6-(1-pyrrolidinyl)-3-pyridinecarboxaldehyde oxime

Description:

2-Methoxy-6-(1-pyrrolidinyl)-3-pyridinecarboxaldehyde oxime is a chemical compound characterized by its complex structure, which includes a pyridine ring, a methoxy group, and an oxime functional group. The presence of the pyrrolidine moiety suggests potential interactions with biological systems, making it of interest in medicinal chemistry. This compound is likely to exhibit moderate polarity due to the methoxy and oxime groups, influencing its solubility in various solvents. The oxime functional group can participate in hydrogen bonding, which may affect its reactivity and stability. Additionally, the compound's structure may allow for various synthetic modifications, potentially leading to derivatives with enhanced biological activity. Its specific applications would depend on its pharmacological properties, which would require further investigation through experimental studies. Overall, 2-Methoxy-6-(1-pyrrolidinyl)-3-pyridinecarboxaldehyde oxime represents a unique scaffold that could be explored for various chemical and biological applications.

Formula: C₁₁H₁₅N₃O₂

InChI: InChI=1S/C11H15N3O2/c1-16-11-9(8-12-15)4-5-10(13-11)14-6-2-3-7-14/h4-5,8,15H,2-3,6-7H2,1H3

InChI key: InChIKey=YOFHZOABMZTSGZ-UHFFFAOYSA-N

SMILES: O(C)C1=NC(=CC=C1C=NO)N2CCCC2

Synonyms:

• 2-Methoxy-6-(1-pyrrolidinyl)-3-pyridinecarboxaldehyde oxime
• 3-Pyridinecarboxaldehyde, 2-methoxy-6-(1-pyrrolidinyl)-, oxime