CAS 1228670-26-5
:Methyl 3-[6-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinyl]-2-propenoate
Description:
Methyl 3-[6-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinyl]-2-propenoate, identified by its CAS number 1228670-26-5, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups. This compound features a methyl ester functional group, a pyridine ring, and a pyrrolidine moiety, contributing to its potential biological activity. The presence of a fluorine atom in the pyridine ring may enhance its lipophilicity and influence its pharmacokinetic properties. Additionally, the dimethylsilyl group provides stability and may affect the compound's reactivity and solubility. Such structural characteristics suggest that this compound could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific properties, such as melting point, boiling point, solubility, and reactivity, would require empirical measurement or detailed computational analysis for precise characterization. Overall, this compound exemplifies the complexity often found in drug-like molecules, which can lead to diverse biological interactions.
Formula:C20H31FN2O3Si
InChI:InChI=1S/C20H31FN2O3Si/c1-20(2,3)27(5,6)26-14-15-11-12-23(13-15)17-9-7-16(19(21)22-17)8-10-18(24)25-4/h7-10,15H,11-14H2,1-6H3
InChI key:InChIKey=GGMHRSYCQVVHIK-UHFFFAOYSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)C1CN(CC1)C=2N=C(F)C(C=CC(OC)=O)=CC2
Synonyms:- 2-Propenoic acid, 3-[6-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinyl]-, methyl ester
- Methyl 3-[6-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-2-fluoro-3-pyridinyl]-2-propenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.