CAS 1228670-27-6

Methyl 3-[2-methoxy-6-(1-pyrrolidinyl)-3-pyridinyl]-2-propenoate

Description:

Methyl 3-[2-methoxy-6-(1-pyrrolidinyl)-3-pyridinyl]-2-propenoate, identified by its CAS number 1228670-27-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a methoxy group, a pyridine ring, and a propenoate moiety. This compound is typically classified as a pyridine derivative and may exhibit properties such as moderate solubility in organic solvents due to its polar functional groups. The presence of the pyrrolidinyl group suggests potential interactions with biological systems, which may indicate pharmacological activity. Its structural features may contribute to its reactivity, making it a candidate for various chemical reactions, including esterification and substitution reactions. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as temperature and pH. Further studies would be necessary to elucidate its specific applications, potential toxicity, and behavior in different chemical environments.

Formula: C₁₄H₁₈N₂O₃

InChI: InChI=1S/C14H18N2O3/c1-18-13(17)8-6-11-5-7-12(15-14(11)19-2)16-9-3-4-10-16/h5-8H,3-4,9-10H2,1-2H3

InChI key: InChIKey=PSIKWHHQFIKLJX-UHFFFAOYSA-N

SMILES: O(C)C1=NC(=CC=C1C=CC(OC)=O)N2CCCC2

Synonyms:

• Methyl 3-[2-methoxy-6-(1-pyrrolidinyl)-3-pyridinyl]-2-propenoate
• 2-Propenoic acid, 3-[2-methoxy-6-(1-pyrrolidinyl)-3-pyridinyl]-, methyl ester