CAS 1228670-39-0

Methyl 3-[1-(2,2-dimethyl-1-oxopropyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl]-2-propenoate

Description:

Methyl 3-[1-(2,2-dimethyl-1-oxopropyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl]-2-propenoate is a complex organic compound characterized by its unique molecular structure, which includes a pyrido[2,3-b][1,4]oxazine core. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of a propenoate moiety suggests potential for participation in various chemical reactions, such as Michael additions or polymerization processes. The compound's structure indicates it may exhibit biological activity, possibly serving as a lead compound in pharmaceutical research. Its molecular weight, solubility, and stability under different conditions would be critical for applications in synthesis or drug development. Additionally, the presence of multiple functional groups may influence its interaction with biological targets, making it a subject of interest in medicinal chemistry. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various scientific fields.

Formula: C₁₆H₂₀N₂O₄

InChI: InChI=1S/C16H20N2O4/c1-16(2,3)15(20)18-9-10-22-14-12(18)7-5-11(17-14)6-8-13(19)21-4/h5-8H,9-10H2,1-4H3

InChI key: InChIKey=JOKGVNAMZSXHMR-UHFFFAOYSA-N

SMILES: C(C(C)(C)C)(=O)N1C=2C(=NC(C=CC(OC)=O)=CC2)OCC1

Synonyms:

• Methyl 3-[1-(2,2-dimethyl-1-oxopropyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl]-2-propenoate
• 2-Propenoic acid, 3-[1-(2,2-dimethyl-1-oxopropyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl]-, methyl ester