CAS 1228670-57-2

1-(2,2-Dimethyl-1-oxopropyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-6-carboxaldehyde 6-oxime

Description:

1-(2,2-Dimethyl-1-oxopropyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-6-carboxaldehyde 6-oxime, with CAS number 1228670-57-2, is a complex organic compound characterized by its unique structural features, including a pyrido[2,3-b][1,4]oxazine core. This compound contains multiple functional groups, such as an oxime and an aldehyde, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the dimethyl-1-oxopropyl substituent suggests that it may exhibit interesting steric and electronic properties, potentially influencing its biological activity. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. While specific biological activities or applications may not be widely documented, compounds of this structural type are often investigated for their potential as pharmaceuticals or agrochemicals. Further studies would be necessary to elucidate its full range of characteristics and potential uses in various fields of chemistry and biology.

Formula: C₁₃H₁₇N₃O₃

InChI: InChI=1S/C13H17N3O3/c1-13(2,3)12(17)16-6-7-19-11-10(16)5-4-9(15-11)8-14-18/h4-5,8,18H,6-7H2,1-3H3

InChI key: InChIKey=GLFTZDBNOQWMBQ-UHFFFAOYSA-N

SMILES: C(C(C)(C)C)(=O)N1C=2C(=NC(C=NO)=CC2)OCC1

Synonyms:

• 1-(2,2-Dimethyl-1-oxopropyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-6-carboxaldehyde 6-oxime
• 1H-Pyrido[2,3-b][1,4]oxazine-6-carboxaldehyde, 1-(2,2-dimethyl-1-oxopropyl)-2,3-dihydro-, 6-oxime
• (E)-1-Pivaloyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]-oxazine-6-carbaldehyde oxime