CAS 1228675-23-7
:2-(1,1-Dimethylethyl) 5-(9H-fluoren-9-ylmethyl) 2,5-diazabicyclo[4.1.0]heptane-2,5-dicarboxylate
Description:
2-(1,1-Dimethylethyl) 5-(9H-fluoren-9-ylmethyl) 2,5-diazabicyclo[4.1.0]heptane-2,5-dicarboxylate is a complex organic compound characterized by its bicyclic structure, which includes a diazabicyclo framework. This compound features two carboxylate functional groups, contributing to its potential reactivity and solubility in various solvents. The presence of a 9H-fluoren-9-ylmethyl group enhances its aromatic character, which may influence its electronic properties and stability. The tert-butyl group (1,1-dimethylethyl) provides steric hindrance, potentially affecting the compound's interactions with other molecules. This compound may exhibit interesting biological or chemical properties due to its unique structure, making it a candidate for research in fields such as medicinal chemistry or materials science. Its specific applications and behavior would depend on further studies, including its synthesis, stability under different conditions, and interactions with other chemical species. As with many complex organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C25H28N2O4
InChI:InChI=1S/C25H28N2O4/c1-25(2,3)31-24(29)27-13-12-26(21-14-22(21)27)23(28)30-15-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20/h4-11,20-22H,12-15H2,1-3H3
InChI key:InChIKey=JPRGEENLSVYMEI-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C2C(C2)N(C(OCC3C=4C(C=5C3=CC=CC5)=CC=CC4)=O)CC1
Synonyms:- 2,5-Diazabicyclo[4.1.0]heptane-2,5-dicarboxylic acid, 2-(1,1-dimethylethyl) 5-(9H-fluoren-9-ylmethyl) ester
- 2-((9H-Fluoren-9-yl)methyl) 5-tert-butyl 2,5-diazabicyclo[4.1.0]heptane-2,5-dicarboxylate
- 2-(1,1-Dimethylethyl) 5-(9H-fluoren-9-ylmethyl) 2,5-diazabicyclo[4.1.0]heptane-2,5-dicarboxylate
- 2-((9H-fluoren-9-yl)methyl) 5-tert-butyl 2,5-diazabicyclo[4.1.0]heptane-2,5-dicarboxylate(WXC06992)
- 2-((9H-Fluoren-9-yl)methyl) 5-(tert-butyl) (1S,6R)-2,5-diazabicyclo[4.1.0]heptane-2,5-dicarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.