CAS 1228690-38-7: Ethyl 4′-[3-methyl-4-[[[(1R)-1-phenylethoxy]carbonyl]amino]-5-isoxazolyl][1,1′-biphenyl]-4-acetate
Description:Ethyl 4′-[3-methyl-4-[[[(1R)-1-phenylethoxy]carbonyl]amino]-5-isoxazolyl][1,1′-biphenyl]-4-acetate, identified by its CAS number 1228690-38-7, is a complex organic compound characterized by its multi-functional structure. It features an ethyl acetate moiety, which contributes to its solubility and reactivity. The presence of an isoxazole ring indicates potential biological activity, as isoxazoles are often found in pharmaceuticals and agrochemicals. The compound also contains a biphenyl structure, which can enhance its stability and influence its electronic properties. The incorporation of a phenylethoxy group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of various functional groups, including carbonyl and amino groups, may facilitate hydrogen bonding and other intermolecular interactions, impacting its overall reactivity and biological profile. Overall, this compound's unique structural features may contribute to its potential applications in drug development or as a chemical probe in biological research.
Formula:C29H28N2O5
InChI:InChI=1S/C29H28N2O5/c1-4-34-26(32)18-21-10-12-23(13-11-21)24-14-16-25(17-15-24)28-27(19(2)31-36-28)30-29(33)35-20(3)22-8-6-5-7-9-22/h5-17,20H,4,18H2,1-3H3,(H,30,33)/t20-/m1/s1
InChI key:InChIKey=QGPQAZHGXUJBRV-HXUWFJFHSA-N
SMILES:O=C(OC(C=1C=CC=CC1)C)NC2=C(ON=C2C)C=3C=CC(=CC3)C=4C=CC(=CC4)CC(=O)OCC
- Synonyms:
- [1,1′-Biphenyl]-4-acetic acid, 4′-[3-methyl-4-[[[(1R)-1-phenylethoxy]carbonyl]amino]-5-isoxazolyl]-, ethyl ester
- [4′-[3-Methyl-4-[[[((R)-1-phenylethyl)oxy]carbonyl]amino]isoxazol-5-yl]biphenyl-4-yl]acetic acid ethyl ester
- Ethyl 4′-[3-methyl-4-[[[(1R)-1-phenylethoxy]carbonyl]amino]-5-isoxazolyl][1,1′-biphenyl]-4-acetate

[4'-[3-Methyl-4-[[[((R)-1-phenylethyl)oxy]carbonyl]aMino]isoxazol-5-yl]biphenyl-4-yl]acetic acid ethyl ester
Ref: IN-DA009C5P
100mg | To inquire |

[4'-[3-Methyl-4-[[[((R)-1-phenylethyl)oxy]carbonyl]amino]isoxazol-5-yl]biphenyl-4-yl]acetic acid ethyl ester
Ref: 54-OR89343
100mg | 1,116.00 € | ||
500mg | 3,972.00 € |

[4'-[3-Methyl-4-[[[((R)-1-phenylethyl)oxy]carbonyl]amino]isoxazol-5-yl]biphenyl-4-yl]acetic acid ethyl ester
Ref: 10-F789516
100mg | 566.00 € | ||
500mg | 2,021.00 € |

[4'-[3-Methyl-4-[[[((R)-1-phenylethyl)oxy]carbonyl]amino]isoxazol-5-yl]biphenyl-4-yl]acetic acid ethyl ester
Ref: 3D-DZB69038
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |