CymitQuimica logo

CAS 1228748-76-2

:

Cyclopropyl-2-morpholinylmethanone

Description:
Cyclopropyl-2-morpholinylmethanone, identified by its CAS number 1228748-76-2, is a chemical compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity, and a morpholine moiety, a six-membered ring containing both oxygen and nitrogen atoms. This combination imparts specific properties, such as potential biological activity and solubility characteristics. The presence of the carbonyl group (ketone) in the structure suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Cyclopropyl-2-morpholinylmethanone may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its reactivity and stability can be influenced by the steric and electronic effects of the cyclopropyl and morpholine groups. Overall, this compound's unique structure positions it as a potentially valuable entity in the development of new therapeutic agents or chemical probes.
Formula:C8H13NO2
InChI:InChI=1S/C8H13NO2/c10-8(6-1-2-6)7-5-9-3-4-11-7/h6-7,9H,1-5H2
InChI key:InChIKey=DKYJGCAZSUHWLE-UHFFFAOYSA-N
SMILES:C(=O)(C1CC1)C2CNCCO2
Synonyms:
  • Methanone, cyclopropyl-2-morpholinyl-
  • Cyclopropyl-2-morpholinylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.