CymitQuimica logo

CAS 1228776-05-3

:

Isothiazolidine, 2-(3-iodophenyl)-, 1,1-dioxide

Description:
Isothiazolidine, 2-(3-iodophenyl)-, 1,1-dioxide, identified by its CAS number 1228776-05-3, is a heterocyclic compound featuring a five-membered ring containing both sulfur and nitrogen atoms. This compound is characterized by the presence of a 3-iodophenyl group, which contributes to its unique chemical properties and potential biological activity. The 1,1-dioxide functional group indicates the presence of two double-bonded oxygen atoms, enhancing its reactivity and solubility in various solvents. Isothiazolidines are known for their diverse applications, particularly in medicinal chemistry, where they may exhibit antimicrobial, antifungal, or anti-inflammatory properties. The iodine substituent can also influence the compound's electronic properties and reactivity, making it a subject of interest in synthetic chemistry and drug development. Overall, this compound's structural features suggest potential utility in various chemical and pharmaceutical applications, although specific biological activities and mechanisms would require further investigation.
Formula:C9H10INO2S
InChI:InChI=1S/C9H10INO2S/c10-8-3-1-4-9(7-8)11-5-2-6-14(11,12)13/h1,3-4,7H,2,5-6H2
InChI key:InChIKey=BKPVOQPEUGHOAW-UHFFFAOYSA-N
SMILES:O=S1(=O)N(C2=CC(I)=CC=C2)CCC1
Synonyms:
  • Isothiazolidine, 2-(3-iodophenyl)-, 1,1-dioxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.