CAS 1228821-98-4

2-(Hydroxymethyl)-1-piperidineacetic acid

Description:

2-(Hydroxymethyl)-1-piperidineacetic acid, with the CAS number 1228821-98-4, is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a hydroxymethyl group (-CH2OH) and a carboxylic acid group (-COOH) attached to the piperidine ring, contributing to its potential as a versatile building block in medicinal chemistry. The presence of the hydroxymethyl group enhances its solubility in water, while the carboxylic acid group provides acidic properties, allowing for potential interactions in biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or metabolic disorders. Its structural features suggest that it could participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. Overall, 2-(Hydroxymethyl)-1-piperidineacetic acid represents a unique chemical entity with potential applications in various fields, including drug development and organic synthesis.

Formula: C₈H₁₅NO₃

InChI: InChI=1S/C8H15NO3/c10-6-7-3-1-2-4-9(7)5-8(11)12/h7,10H,1-6H2,(H,11,12)

InChI key: InChIKey=RSPRETOHSPZQBB-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C(CO)CCCC1

Synonyms:

• 2-[2-(Hydroxymethyl)piperidin-1-yl]acetic acid
• 1-Piperidineacetic acid, 2-(hydroxymethyl)-
• 2-(Hydroxymethyl)-1-piperidineacetic acid