CAS 1228829-16-0
:B-(2-Chloro-4-formyl-6-methylphenyl)boronic acid
Description:
B-(2-Chloro-4-formyl-6-methylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. The compound features a chlorinated aromatic ring with a formyl group and a methyl substituent, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the boronic acid moiety allows for the formation of stable complexes with biomolecules, which can be exploited in drug development and material science. Additionally, the chlorinated and formyl substituents can influence the electronic properties and steric hindrance of the molecule, affecting its reactivity and interaction with other chemical species. Overall, this compound represents a versatile building block in synthetic organic chemistry, with potential applications in the development of pharmaceuticals and advanced materials.
Formula:C8H8BClO3
InChI:InChI=1S/C8H8BClO3/c1-5-2-6(4-11)3-7(10)8(5)9(12)13/h2-4,12-13H,1H3
InChI key:InChIKey=WSVNUBUNPZYJPZ-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(C)C=C(C=O)C=C1Cl
Synonyms:- Boronic acid, B-(2-chloro-4-formyl-6-methylphenyl)-
- B-(2-Chloro-4-formyl-6-methylphenyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
