CAS 1228880-20-3

2-Pyridinemethanamine, α-ethyl-, hydrochloride (1:2)

Description:

2-Pyridinemethanamine, α-ethyl-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which contributes to its basicity and potential for forming hydrogen bonds. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the ethyl group at the alpha position of the amine influences its steric and electronic properties, potentially affecting its reactivity and interaction with biological systems. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a ligand in coordination chemistry. Its hydrochloride form indicates that it can be used in formulations where stability and solubility are critical. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, this compound's characteristics make it of interest in both research and industrial applications.

Formula: C₈H₁₂N₂·2ClH

InChI: InChI=1S/C8H12N2.2ClH/c1-2-7(9)8-5-3-4-6-10-8;;/h3-7H,2,9H2,1H3;2*1H

InChI key: InChIKey=ORURRAVEPLPSIJ-UHFFFAOYSA-N

SMILES: C(CC)(N)C1=CC=CC=N1.Cl

Synonyms:

• 2-Pyridinemethanamine, α-ethyl-, hydrochloride (1:2)
• 1-(Pyridin-2-yl)propan-1-amine dihydrochloride

[1-(2-pyridinyl)propyl]amine dihydrochloride

CAS: 1228880-20-3

Formula: C₈H₁₄Cl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 209.1162

Ref: IN-DA00J1OY

1-(Pyridin-2-yl)propan-1-amine dihydrochloride

CAS: 1228880-20-3

1-(Pyridin-2-yl)propan-1-amine dihydrochloride

Purity: 95%

Molecular weight: 209.12g/mol

Ref: 54-OR83370

[1-(2-Pyridinyl)propyl]amine dihydrochloride

CAS: 1228880-20-3

Formula: C₈H₁₄Cl₂N₂

Purity: 95%

Molecular weight: 209.11

Ref: 10-F359670